[(1S,4S,5S,6R,9S,10R,12R,14R)-7-(acetyloxymethyl)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-[[3-hydroxy-2-[[(E)-2-methylbut-2-enoyl]amino]benzoyl]amino]benzoate
| Internal ID | 45e36794-b9db-4861-b231-07a786fc2dc9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Tigliane and ingenane diterpenoids |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-7-(acetyloxymethyl)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-[[3-hydroxy-2-[[(E)-2-methylbut-2-enoyl]amino]benzoyl]amino]benzoate |
| SMILES (Canonical) | CC=C(C)C(=O)NC1=C(C=CC=C1O)C(=O)NC2=CC=CC=C2C(=O)OC3C(=CC45C3(C(C(=CC(C4=O)C6C(C6(C)C)CC5C)COC(=O)C)O)O)C |
| SMILES (Isomeric) | C/C=C(\C)/C(=O)NC1=C(C=CC=C1O)C(=O)NC2=CC=CC=C2C(=O)O[C@H]3C(=C[C@@]45[C@@]3([C@@H](C(=C[C@H](C4=O)[C@H]6[C@H](C6(C)C)C[C@H]5C)COC(=O)C)O)O)C |
| InChI | InChI=1S/C41H46N2O10/c1-8-20(2)36(48)43-32-26(13-11-15-30(32)45)37(49)42-29-14-10-9-12-25(29)38(50)53-35-21(3)18-40-22(4)16-28-31(39(28,6)7)27(34(40)47)17-24(19-52-23(5)44)33(46)41(35,40)51/h8-15,17-18,22,27-28,31,33,35,45-46,51H,16,19H2,1-7H3,(H,42,49)(H,43,48)/b20-8+/t22-,27+,28-,31+,33-,35+,40+,41+/m1/s1 |
| InChI Key | GMCHDUVWKRKYAC-FATCGTTPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H46N2O10 |
| Molecular Weight | 726.80 g/mol |
| Exact Mass | 726.31524567 g/mol |
| Topological Polar Surface Area (TPSA) | 189.00 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 99.91% | 95.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 99.01% | 97.79% |
| CHEMBL240 | Q12809 | HERG | 98.38% | 89.76% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.37% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.35% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.50% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.40% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.57% | 82.69% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 93.20% | 91.07% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.86% | 94.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.60% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.01% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.82% | 91.49% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.20% | 91.19% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.75% | 89.63% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.62% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.56% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.81% | 94.73% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.88% | 91.24% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.58% | 95.50% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.76% | 92.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.88% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.71% | 94.45% |
| CHEMBL5028 | O14672 | ADAM10 | 84.53% | 97.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.51% | 98.75% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.40% | 95.58% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.16% | 89.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.38% | 85.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.66% | 96.67% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.57% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia milii |
| PubChem | 163194954 |
| LOTUS | LTS0124036 |
| wikiData | Q105011668 |