(1R,2S,4S,7S,8R,9S,12S,13R,16S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one
Internal ID | a1bb67d0-b357-4520-b6be-f4ec1c5cd67d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,2S,4S,7S,8R,9S,12S,13R,16S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(C(=O)CC5C4CC=C6C5(CCC(C6)O)C)C)C)OC1 |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(C(=O)C[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O)C)C)OC16CCC(CO6)C |
InChI | InChI=1S/C27H40O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)12-21-19-6-5-17-11-18(28)8-9-25(17,3)20(19)13-23(29)26(21,24)4/h5,15-16,18-22,24,28H,6-14H2,1-4H3/t15?,16-,18-,19+,20-,21-,22-,24-,25-,26+,27?/m0/s1 |
InChI Key | UVLDESQWQRMYKD-BTMYMLLZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H40O4 |
Molecular Weight | 428.60 g/mol |
Exact Mass | 428.29265975 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of (1R,2S,4S,7S,8R,9S,12S,13R,16S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one 2D Structure of (1R,2S,4S,7S,8R,9S,12S,13R,16S)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/40c47920-860d-11ee-8d3f-076dceb0fadc.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.79% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.19% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.18% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.72% | 82.69% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.12% | 93.04% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.04% | 96.95% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.36% | 86.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.35% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.98% | 99.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.23% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.84% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.97% | 95.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.84% | 92.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.53% | 95.38% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.10% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Heteropolygonatum alte-lobatum |
PubChem | 6451913 |
LOTUS | LTS0050752 |
wikiData | Q105279945 |