(1R,2R,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2-diol
| Internal ID | 3d04ba48-f8d0-42cb-91ce-bf7d88e1e9d3 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | (1R,2R,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2-diol |
| SMILES (Canonical) | CC1CCC2(C(C1(C)CCC3=COC=C3)CCC(C2(C)O)O)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@@H]([C@@]1(C)CCC3=COC=C3)CC[C@H]([C@]2(C)O)O)C |
| InChI | InChI=1S/C20H32O3/c1-14-7-11-19(3)16(5-6-17(21)20(19,4)22)18(14,2)10-8-15-9-12-23-13-15/h9,12-14,16-17,21-22H,5-8,10-11H2,1-4H3/t14-,16-,17-,18+,19-,20+/m1/s1 |
| InChI Key | GNWZEPMTZKFXQV-IOFZNDEASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.23514488 g/mol |
| Topological Polar Surface Area (TPSA) | 53.60 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of (1R,2R,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/11/409f59e0-858e-11ee-a7a9-478a4d333dbf.jpg "2D Structure of (1R,2R,4aR,5S,6R,8aR)-5-[2-(furan-3-yl)ethyl]-1,5,6,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalene-1,2-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.28% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.17% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.15% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.38% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.99% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.68% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.52% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.83% | 86.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.84% | 97.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.62% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.08% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.98% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Croton laui |
| PubChem | 90676768 |
| LOTUS | LTS0190809 |
| wikiData | Q105013416 |