[3,17-Diacetyloxy-15-(furan-3-yl)-10-(2-hydroxy-3-methylbutanoyl)oxy-2,7,11,16-tetramethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-7-yl]methyl 2-hydroxy-3-methylpentanoate
| Internal ID | 4b429e32-2628-496f-ae51-5dcc01dbff76 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | [3,17-diacetyloxy-15-(furan-3-yl)-10-(2-hydroxy-3-methylbutanoyl)oxy-2,7,11,16-tetramethyl-5-oxo-6-oxatetracyclo[9.7.0.02,8.012,16]octadec-12-en-7-yl]methyl 2-hydroxy-3-methylpentanoate |
| SMILES (Canonical) | CCC(C)C(C(=O)OCC1(C2CC(C3(C(C2(C(CC(=O)O1)OC(=O)C)C)CC(C4(C3=CCC4C5=COC=C5)C)OC(=O)C)C)OC(=O)C(C(C)C)O)C)O |
| SMILES (Isomeric) | CCC(C)C(C(=O)OCC1(C2CC(C3(C(C2(C(CC(=O)O1)OC(=O)C)C)CC(C4(C3=CCC4C5=COC=C5)C)OC(=O)C)C)OC(=O)C(C(C)C)O)C)O |
| InChI | InChI=1S/C41H58O13/c1-11-22(4)35(46)36(47)50-20-38(7)28-16-31(53-37(48)34(45)21(2)3)40(9)27-13-12-26(25-14-15-49-19-25)39(27,8)30(51-23(5)42)17-29(40)41(28,10)32(52-24(6)43)18-33(44)54-38/h13-15,19,21-22,26,28-32,34-35,45-46H,11-12,16-18,20H2,1-10H3 |
| InChI Key | FSWAAEDJSLUWHZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H58O13 |
| Molecular Weight | 758.90 g/mol |
| Exact Mass | 758.38774190 g/mol |
| Topological Polar Surface Area (TPSA) | 185.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.83% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.74% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.51% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.25% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.89% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.74% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.41% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.83% | 97.09% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.09% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.37% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.45% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 82.17% | 97.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.73% | 97.79% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.70% | 97.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.53% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.07% | 91.19% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 81.01% | 89.92% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.93% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.92% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.25% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.02% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Trichilia rubra |
| PubChem | 73092255 |
| LOTUS | LTS0084624 |
| wikiData | Q105000901 |