2-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5-hydroxy-7-methoxychromen-4-one
Internal ID | 89125e44-c374-4976-967c-987631aa06ae |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 2-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5-hydroxy-7-methoxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC=C(C=C3)C4=CC(=O)C5=C(C=C(C=C5O4)OC)O)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H]([C@H](O[C@H]2OC3=CC=C(C=C3)C4=CC(=O)C5=C(C=C(C=C5O4)OC)O)CO)O)O)O)O)O |
InChI | InChI=1S/C28H32O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-13-5-3-12(4-6-13)17-9-16(31)20-15(30)7-14(37-2)8-18(20)40-17/h3-9,11,19,21-30,32-36H,10H2,1-2H3/t11-,19+,21-,22-,23-,24-,25+,26+,27-,28+/m0/s1 |
InChI Key | BYPZWJJKOJGVCM-GXQDQMLYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O14 |
Molecular Weight | 592.50 g/mol |
Exact Mass | 592.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of 2-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5-hydroxy-7-methoxychromen-4-one 2D Structure of 2-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxyphenyl]-5-hydroxy-7-methoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/40573e80-86c5-11ee-b98e-dfd181c957ca.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.68% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.83% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.62% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.10% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.60% | 91.49% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.92% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.51% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.17% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.30% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.30% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.63% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.38% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.02% | 96.09% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.03% | 93.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.61% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 83.14% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.98% | 90.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.96% | 95.89% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.67% | 83.57% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.58% | 90.71% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.62% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia moorcroftiana |
PubChem | 11114610 |
LOTUS | LTS0066193 |
wikiData | Q104949690 |