(1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-(3,4,5-trimethoxybenzoyl)oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid
Internal ID | 3193a4b5-e030-4672-8c9e-80540d1c7d29 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-(3,4,5-trimethoxybenzoyl)oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid |
SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C36CC6CC2(CC1OC(=O)C7=CC(=C(C(=C7)OC)OC)OC)C(=O)O)C)(C)C)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(CO9)O)O)O)C)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]35C[C@@H]5C[C@@]6([C@H]4CC([C@H](C6)OC(=O)C7=CC(=C(C(=C7)OC)OC)OC)(C)C)C(=O)O)C)(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O |
InChI | InChI=1S/C51H74O17/c1-46(2)20-27-26-10-11-33-48(5)14-13-34(67-44-41(38(56)37(55)31(22-52)65-44)68-43-39(57)36(54)28(53)23-64-43)47(3,4)32(48)12-15-49(33,6)51(26)19-25(51)18-50(27,45(59)60)21-35(46)66-42(58)24-16-29(61-7)40(63-9)30(17-24)62-8/h10,16-17,25,27-28,31-39,41,43-44,52-57H,11-15,18-23H2,1-9H3,(H,59,60)/t25-,27-,28+,31+,32-,33+,34-,35-,36-,37+,38-,39+,41+,43-,44-,48-,49+,50+,51+/m0/s1 |
InChI Key | SBNHOGAXBFZLIY-ICLYBJHESA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H74O17 |
Molecular Weight | 959.10 g/mol |
Exact Mass | 958.49260089 g/mol |
Topological Polar Surface Area (TPSA) | 250.00 Ų |
XlogP | 4.70 |
There are no found synonyms. |
![2D Structure of (1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-(3,4,5-trimethoxybenzoyl)oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid 2D Structure of (1S,2R,5R,7S,10R,11R,15S,18S,20R,22R)-7-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,6,6,10,17,17-hexamethyl-18-(3,4,5-trimethoxybenzoyl)oxyhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/405712f0-8433-11ee-a6f0-05ec804927b1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4302 | P08183 | P-glycoprotein 1 | 98.37% | 92.98% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.86% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.38% | 96.77% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.98% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.10% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.31% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.64% | 92.62% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.22% | 96.21% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.76% | 90.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.83% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.22% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.80% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.63% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.48% | 97.50% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.58% | 95.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.97% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.56% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.77% | 95.83% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.59% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.47% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.28% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Verbesina virginica |
PubChem | 162949733 |
LOTUS | LTS0101852 |
wikiData | Q105249558 |