(2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3R)-2-[[(2R,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid
| Internal ID | d94a1ac1-7a1a-4c2d-bc2c-86d86dad2d5c |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3R)-2-[[(2R,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)N(C)C(CC(C)C)C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)O)NC(=O)C(C(CCCCCCCCl)N)O |
| SMILES (Isomeric) | CC[C@@H](C)[C@@H](C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O)NC(=O)[C@@H]([C@@H](CCCCCCCCl)N)O |
| InChI | InChI=1S/C37H60ClN5O8/c1-6-24(4)31(41-34(47)32(45)27(39)13-10-8-7-9-11-19-38)36(49)42(5)30(21-23(2)3)35(48)43-20-12-14-29(43)33(46)40-28(37(50)51)22-25-15-17-26(44)18-16-25/h15-18,23-24,27-32,44-45H,6-14,19-22,39H2,1-5H3,(H,40,46)(H,41,47)(H,50,51)/t24-,27-,28+,29+,30+,31+,32-/m1/s1 |
| InChI Key | VERJLHWODWFYHF-MHWYMEAKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C37H60ClN5O8 |
| Molecular Weight | 738.40 g/mol |
| Exact Mass | 737.4130416 g/mol |
| Topological Polar Surface Area (TPSA) | 203.00 Ų |
| XlogP | 2.50 |
| Atomic LogP (AlogP) | 3.17 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 22 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8026 | 80.26% |
| Caco-2 | - | 0.8638 | 86.38% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Mitochondria | 0.4706 | 47.06% |
| OATP2B1 inhibitior | - | 0.5713 | 57.13% |
| OATP1B1 inhibitior | + | 0.8630 | 86.30% |
| OATP1B3 inhibitior | + | 0.9293 | 92.93% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.7662 | 76.62% |
| P-glycoprotein inhibitior | + | 0.7279 | 72.79% |
| P-glycoprotein substrate | + | 0.8390 | 83.90% |
| CYP3A4 substrate | + | 0.7361 | 73.61% |
| CYP2C9 substrate | - | 0.5966 | 59.66% |
| CYP2D6 substrate | - | 0.7804 | 78.04% |
| CYP3A4 inhibition | - | 0.6818 | 68.18% |
| CYP2C9 inhibition | - | 0.8573 | 85.73% |
| CYP2C19 inhibition | - | 0.8103 | 81.03% |
| CYP2D6 inhibition | - | 0.8692 | 86.92% |
| CYP1A2 inhibition | - | 0.8647 | 86.47% |
| CYP2C8 inhibition | + | 0.6382 | 63.82% |
| CYP inhibitory promiscuity | - | 0.9311 | 93.11% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.7900 | 79.00% |
| Carcinogenicity (trinary) | Non-required | 0.6225 | 62.25% |
| Eye corrosion | - | 0.9876 | 98.76% |
| Eye irritation | - | 0.9190 | 91.90% |
| Skin irritation | - | 0.7648 | 76.48% |
| Skin corrosion | - | 0.9183 | 91.83% |
| Ames mutagenesis | - | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4649 | 46.49% |
| Micronuclear | + | 0.8300 | 83.00% |
| Hepatotoxicity | + | 0.5802 | 58.02% |
| skin sensitisation | - | 0.8621 | 86.21% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9250 | 92.50% |
| Nephrotoxicity | - | 0.8946 | 89.46% |
| Acute Oral Toxicity (c) | III | 0.5990 | 59.90% |
| Estrogen receptor binding | + | 0.8350 | 83.50% |
| Androgen receptor binding | + | 0.7100 | 71.00% |
| Thyroid receptor binding | + | 0.5268 | 52.68% |
| Glucocorticoid receptor binding | + | 0.6319 | 63.19% |
| Aromatase binding | + | 0.5830 | 58.30% |
| PPAR gamma | + | 0.7323 | 73.23% |
| Honey bee toxicity | - | 0.8058 | 80.58% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.5628 | 56.28% |
| Fish aquatic toxicity | + | 0.9353 | 93.53% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.91% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.80% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.15% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 99.05% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.14% | 93.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.58% | 93.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.30% | 89.63% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.36% | 98.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.86% | 99.17% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 95.69% | 96.67% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.49% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.36% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.79% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.56% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.45% | 98.10% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.08% | 95.56% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 91.80% | 91.76% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.73% | 90.17% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 91.43% | 95.52% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.12% | 100.00% |
| CHEMBL268 | P43235 | Cathepsin K | 91.07% | 96.85% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 90.89% | 98.24% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 90.35% | 97.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.07% | 90.08% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.91% | 100.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 89.63% | 97.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.41% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.39% | 97.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.06% | 95.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.99% | 90.20% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.74% | 93.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.31% | 97.14% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 86.40% | 97.43% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.88% | 96.03% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 85.54% | 97.64% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 85.32% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.29% | 92.86% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.23% | 97.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.95% | 91.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.79% | 96.47% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.63% | 95.34% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.38% | 96.37% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.45% | 99.18% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.21% | 94.45% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.20% | 97.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.87% | 94.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.07% | 90.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.98% | 99.35% |
| CHEMBL204 | P00734 | Thrombin | 81.70% | 96.01% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.43% | 82.86% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.14% | 93.67% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.64% | 93.99% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.60% | 82.38% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.14% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163020368 |
| LOTUS | LTS0064787 |
| wikiData | Q105284801 |