Aeruginol
| Internal ID | 5df3b3fa-e21d-4523-be71-c6bf6ba59e1e |
| Taxonomy | Organoheterocyclic compounds > Azoles > Thiazoles > 2,4-disubstituted thiazoles |
| IUPAC Name | 2-[4-(hydroxymethyl)-1,3-thiazol-2-yl]phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H9NO2S/c12-5-7-6-14-10(11-7)8-3-1-2-4-9(8)13/h1-4,6,12-13H,5H2 |
| InChI Key | BOSGDCHVRSIZSY-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.03539970 g/mol |
| Topological Polar Surface Area (TPSA) | 81.60 Ų |
| XlogP | 1.40 |
| 154037-50-0 |
| 4-Thiazolemethanol, 2-(2-hydroxyphenyl)- |
| 2-(4-(Hydroxymethyl)thiazol-2-yl)phenol |
| starbld0007274 |
| 2-(2'-Hydroxyphenyl)-4-hydroxymethylthiazole |
| SCHEMBL21883091 |
| AKOS040750157 |
| 2-(2'-hydroxyphenyl)-4-hydroxymethyl-thiazole |
| 2-[4-(hydroxymethyl)-1,3-thiazol-2-yl]phenol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.37% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.09% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.13% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.84% | 99.15% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.05% | 82.69% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.16% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.87% | 95.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.14% | 93.10% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.56% | 93.03% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.06% | 96.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.69% | 99.23% |
| CHEMBL2828 | P48730 | Casein kinase I delta | 80.98% | 93.08% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.83% | 89.63% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.78% | 85.49% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 80.48% | 93.81% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.31% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 192662 |
| LOTUS | LTS0210172 |
| wikiData | Q104939540 |