4'-O-Methylderrone
Internal ID | ead54c7f-24e4-4dee-9ed5-23101ca54534 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Pyranoisoflavonoids |
IUPAC Name | 5-hydroxy-3-(4-methoxyphenyl)-8,8-dimethylpyrano[2,3-h]chromen-4-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=C(C3=C2OC=C(C3=O)C4=CC=C(C=C4)OC)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C(C3=C2OC=C(C3=O)C4=CC=C(C=C4)OC)O)C |
InChI | InChI=1S/C21H18O5/c1-21(2)9-8-14-17(26-21)10-16(22)18-19(23)15(11-25-20(14)18)12-4-6-13(24-3)7-5-12/h4-11,22H,1-3H3 |
InChI Key | TYGQXJXSHGOEKP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H18O5 |
Molecular Weight | 350.40 g/mol |
Exact Mass | 350.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 4.30 |
Derrone-4'-O-methyl ether |
DTXSID301311895 |
LMPK12050228 |
34086-52-7 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.69% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.80% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.55% | 94.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 92.24% | 93.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.27% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.79% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.77% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.60% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.14% | 93.99% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.36% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.26% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.99% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.15% | 96.77% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.28% | 95.71% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 84.20% | 95.53% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.94% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.45% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.02% | 97.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.70% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euchresta horsfieldii |
PubChem | 15596286 |
LOTUS | LTS0224521 |
wikiData | Q105267304 |