4-(Methylnitrosamino)-1-(3-Pyridyl)-1-Butanol
| Internal ID | 6da49042-8d1e-4501-bc7d-deaa29341c2a |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives |
| IUPAC Name | N-(4-hydroxy-4-pyridin-3-ylbutyl)-N-methylnitrous amide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H15N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8,10,14H,3,5,7H2,1H3 |
| InChI Key | OGRXKBUCZFFSTL-UHFFFAOYSA-N |
| Popularity | 420 references in papers |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.116426730 g/mol |
| Topological Polar Surface Area (TPSA) | 65.80 Ų |
| XlogP | 0.70 |
| nnal |
| 76014-81-8 |
| N-(4-hydroxy-4-pyridin-3-ylbutyl)-N-methylnitrous amide |
| EN7PIX794W |
| 4-(N-Methyl-N-nitrosamino)-1-(3-pyridyl)butan-1-ol |
| DTXSID8020880 |
| alpha-(3-(Methylnitrosoamino)propyl)-3-pyridinemethanol |
| CCRIS 3049 |
| Racemic NNAL |
| UNII-EN7PIX794W |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.39% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.50% | 94.73% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 88.84% | 93.81% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.52% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.19% | 96.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.10% | 89.34% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.08% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.36% | 94.45% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.56% | 93.65% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 80.14% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 104856 |
| LOTUS | LTS0191922 |
| wikiData | Q27156083 |