4-Methylindeno[2,1-b]pyridin-9-one
| Internal ID | 040dea34-a315-4253-a9f5-37a40c7121f5 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones |
| IUPAC Name | 4-methylindeno[2,1-b]pyridin-9-one |
| SMILES (Canonical) | CC1=C2C3=CC=CC=C3C(=O)C2=NC=C1 |
| SMILES (Isomeric) | CC1=C2C3=CC=CC=C3C(=O)C2=NC=C1 |
| InChI | InChI=1S/C13H9NO/c1-8-6-7-14-12-11(8)9-4-2-3-5-10(9)13(12)15/h2-7H,1H3 |
| InChI Key | YDCSRSRWPHXQLV-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.068413911 g/mol |
| Topological Polar Surface Area (TPSA) | 30.00 Ų |
| XlogP | 2.70 |
| SCHEMBL23235907 |
![2D Structure of 4-Methylindeno[2,1-b]pyridin-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/4-methylindeno21-bpyridin-9-one.jpg "2D Structure of 4-Methylindeno[2,1-b]pyridin-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.64% | 98.95% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 93.67% | 96.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.83% | 95.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.80% | 93.65% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.62% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.74% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.62% | 99.23% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 86.70% | 96.47% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.31% | 86.33% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.61% | 100.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.43% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.66% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.50% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.33% | 93.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.15% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cleistopholis patens |
| Guatteria blepharophylla |
| Onychopetalum amazonicum |
| PubChem | 14626439 |
| LOTUS | LTS0085127 |
| wikiData | Q105346661 |