4-Methylcholest-7-en-3-ol
Internal ID | 69f84c3a-ea69-4525-b65d-75d4c91cef57 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cholestane steroids > Cholesterols and derivatives |
IUPAC Name | 4,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CC1C(CCC2(C1CC=C3C2CCC4(C3CCC4C(C)CCCC(C)C)C)C)O |
SMILES (Isomeric) | CC1C(CCC2(C1CC=C3C2CCC4(C3CCC4C(C)CCCC(C)C)C)C)O |
InChI | InChI=1S/C28H48O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h10,18-20,22-26,29H,7-9,11-17H2,1-6H3 |
InChI Key | LMYZQUNLYGJIHI-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C28H48O |
Molecular Weight | 400.70 g/mol |
Exact Mass | 400.370516150 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.70 |
Cholest-7-en-3-ol, 4-methyl-, (3beta,4alpha,5alpha)- |
SCHEMBL10001888 |
4,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.75% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.95% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.25% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.80% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.07% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 90.63% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.58% | 93.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.25% | 90.71% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.08% | 85.31% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.74% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.39% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.99% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.71% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.27% | 95.89% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.87% | 98.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.51% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.94% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.46% | 94.75% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.01% | 96.43% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.21% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.11% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diplopterygium glaucum |
Solanum tuberosum |
PubChem | 634024 |
LOTUS | LTS0127097 |
wikiData | Q105154202 |