(4-Methyl-2-propan-2-ylphenyl) 2-methylbut-2-enoate
Internal ID | 8d1771f6-5a41-49ee-97f9-0d2a2b7e9b21 |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | (4-methyl-2-propan-2-ylphenyl) 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1=C(C=C(C=C1)C)C(C)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1=C(C=C(C=C1)C)C(C)C |
InChI | InChI=1S/C15H20O2/c1-6-12(5)15(16)17-14-8-7-11(4)9-13(14)10(2)3/h6-10H,1-5H3 |
InChI Key | KRVQPLGJQFNMHY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O2 |
Molecular Weight | 232.32 g/mol |
Exact Mass | 232.146329876 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 4.40 |
There are no found synonyms. |
![2D Structure of (4-Methyl-2-propan-2-ylphenyl) 2-methylbut-2-enoate 2D Structure of (4-Methyl-2-propan-2-ylphenyl) 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-methyl-2-propan-2-ylphenyl-2-methylbut-2-enoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.34% | 97.21% |
CHEMBL2581 | P07339 | Cathepsin D | 91.61% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.46% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.01% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.96% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.23% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.81% | 96.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.77% | 93.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.09% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.08% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.95% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.35% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.29% | 90.71% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 80.50% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bishovia boliviensis |
PubChem | 162982939 |
LOTUS | LTS0250142 |
wikiData | Q105145266 |