4-Methoxyfuro[2,3-b]quinolin-5-ol
| Internal ID | a36a740a-7d35-4672-8de4-c92788b39a4f |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Furanoquinolines |
| IUPAC Name | 4-methoxyfuro[2,3-b]quinolin-5-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H9NO3/c1-15-11-7-5-6-16-12(7)13-8-3-2-4-9(14)10(8)11/h2-6,14H,1H3 |
| InChI Key | RYKRILSIHAQLRC-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.058243149 g/mol |
| Topological Polar Surface Area (TPSA) | 55.50 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.24% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.18% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.88% | 94.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 92.16% | 94.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.81% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.48% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.86% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.57% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.33% | 94.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.78% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.06% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.68% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.16% | 96.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.18% | 93.65% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.14% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.20% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.42% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus japonica |
| PubChem | 162880899 |
| LOTUS | LTS0019385 |
| wikiData | Q105247669 |