4'-Methoxyflavone
| Internal ID | 3875bf72-846f-4055-8a7f-ef3529957652 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 4-O-methylated flavonoids |
| IUPAC Name | 2-(4-methoxyphenyl)chromen-4-one |
| SMILES (Canonical) | COC1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 |
| SMILES (Isomeric) | COC1=CC=C(C=C1)C2=CC(=O)C3=CC=CC=C3O2 |
| InChI | InChI=1S/C16H12O3/c1-18-12-8-6-11(7-9-12)16-10-14(17)13-4-2-3-5-15(13)19-16/h2-10H,1H3 |
| InChI Key | OMICQBVLCVRFGN-UHFFFAOYSA-N |
| Popularity | 87 references in papers |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.078644241 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 3.50 |
| Atomic LogP (AlogP) | 3.47 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 2 |
| 4143-74-2 |
| 2-(4-methoxyphenyl)chromen-4-one |
| 4H-1-Benzopyran-4-one, 2-(4-methoxyphenyl)- |
| DTXSID0063319 |
| RefChem:506182 |
| DTXCID7039915 |
| 223-968-8 |
| 2-(4-methoxyphenyl)-4H-chromen-4-one |
| 4-Methoxy Flavone |
| MFCD00016934 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 1.0000 | 100.00% |
| Caco-2 | + | 0.9152 | 91.52% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | + | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.7381 | 73.81% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9339 | 93.39% |
| OATP1B3 inhibitior | + | 0.9972 | 99.72% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | - | 0.5359 | 53.59% |
| P-glycoprotein inhibitior | - | 0.4468 | 44.68% |
| P-glycoprotein substrate | - | 0.9349 | 93.49% |
| CYP3A4 substrate | + | 0.5678 | 56.78% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7654 | 76.54% |
| CYP3A4 inhibition | + | 0.5150 | 51.50% |
| CYP2C9 inhibition | + | 0.9280 | 92.80% |
| CYP2C19 inhibition | + | 0.9659 | 96.59% |
| CYP2D6 inhibition | - | 0.9105 | 91.05% |
| CYP1A2 inhibition | + | 0.9877 | 98.77% |
| CYP2C8 inhibition | + | 0.5000 | 50.00% |
| CYP inhibitory promiscuity | + | 0.7677 | 76.77% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9213 | 92.13% |
| Carcinogenicity (trinary) | Warning | 0.4409 | 44.09% |
| Eye corrosion | - | 0.7769 | 77.69% |
| Eye irritation | + | 0.7435 | 74.35% |
| Skin irritation | - | 0.5383 | 53.83% |
| Skin corrosion | - | 0.9839 | 98.39% |
| Ames mutagenesis | + | 0.5300 | 53.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3830 | 38.30% |
| Micronuclear | + | 0.7500 | 75.00% |
| Hepatotoxicity | - | 0.5875 | 58.75% |
| skin sensitisation | - | 0.9458 | 94.58% |
| Respiratory toxicity | - | 0.5222 | 52.22% |
| Reproductive toxicity | + | 0.6667 | 66.67% |
| Mitochondrial toxicity | - | 0.6500 | 65.00% |
| Nephrotoxicity | - | 0.6260 | 62.60% |
| Acute Oral Toxicity (c) | III | 0.8488 | 84.88% |
| Estrogen receptor binding | + | 0.9207 | 92.07% |
| Androgen receptor binding | + | 0.9721 | 97.21% |
| Thyroid receptor binding | + | 0.6747 | 67.47% |
| Glucocorticoid receptor binding | + | 0.8445 | 84.45% |
| Aromatase binding | + | 0.8459 | 84.59% |
| PPAR gamma | + | 0.7308 | 73.08% |
| Honey bee toxicity | - | 0.8510 | 85.10% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.7000 | 70.00% |
| Fish aquatic toxicity | + | 0.7814 | 78.14% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
14125.4 nM |
Potency |
via CMAUP
|
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
31622.8 nM |
Potency |
via CMAUP
|
| CHEMBL2524 | P06280 | Alpha-galactosidase A |
44668.4 nM |
Potency |
via CMAUP
|
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
25118.9 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
1995.3 nM 1995.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
1000 nM |
Potency |
via CMAUP
|
| CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
3981.1 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
2818.4 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL2039 | P27338 | Monoamine oxidase B |
27870 nM |
IC50 |
PMID: 20045650
|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
2511.9 nM |
Potency |
via CMAUP
|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
11220.2 nM |
Potency |
via CMAUP
|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
1995.3 nM |
Potency |
via CMAUP
|
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
10000 nM |
Potency |
via CMAUP
|
| CHEMBL6164 | O95271 | Tankyrase-1 |
70.79 nM 70.79 nM 71 nM |
IC50 IC50 IC50 |
PMID: 24116873
via Super-PRED PMID: 24116873 |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.59% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.00% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.85% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 93.70% | 93.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.30% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.02% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.76% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.63% | 99.15% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.27% | 93.99% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 85.99% | 92.67% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 85.76% | 87.67% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.69% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.07% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.62% | 94.73% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.57% | 89.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.55% | 93.65% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.34% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.61% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ammopiptanthus mongolicus |
| Cullen corylifolium |
| PubChem | 77793 |
| NPASS | NPC2771 |
| ChEMBL | CHEMBL16312 |
| LOTUS | LTS0257243 |
| wikiData | Q27195318 |