4-Methoxybenzyl formate
| Internal ID | f34dbc52-fb07-4927-876e-91c2685d4bff |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzyloxycarbonyls |
| IUPAC Name | (4-methoxyphenyl)methyl formate |
| SMILES (Canonical) | COC1=CC=C(C=C1)COC=O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)COC=O |
| InChI | InChI=1S/C9H10O3/c1-11-9-4-2-8(3-5-9)6-12-7-10/h2-5,7H,6H2,1H3 |
| InChI Key | XPDORSROGAZEGY-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 1.70 |
| Anisyl formate |
| 122-91-8 |
| (4-methoxyphenyl)methyl formate |
| p-Methoxybenzyl formate |
| Anisyl alcohol, formate |
| Anisyl methanoate |
| Benzenemethanol, 4-methoxy-, 1-formate |
| p-Methoxybenzyl alcohol, formate |
| BENZENEMETHANOL, 4-METHOXY-, FORMATE |
| p-Anisyl formate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.14% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.56% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.44% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.76% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.48% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.65% | 90.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.70% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.77% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.45% | 91.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.79% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.76% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vanilla planifolia |
| PubChem | 61054 |
| LOTUS | LTS0056163 |
| wikiData | Q27268587 |