4-methoxy-kaempferol-3-O-hexoside
Internal ID | 61f107bb-876d-4803-8b2e-c34d9a5bf6ab |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-2-(4-methoxyphenyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O11/c1-30-11-4-2-9(3-5-11)20-21(17(27)15-12(25)6-10(24)7-13(15)31-20)33-22-19(29)18(28)16(26)14(8-23)32-22/h2-7,14,16,18-19,22-26,28-29H,8H2,1H3 |
InChI Key | MQVRGDZCYDEQML-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.54% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.22% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.25% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.98% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.15% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.87% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.53% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.47% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.60% | 86.92% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.38% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.02% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.95% | 90.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 87.87% | 95.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.80% | 97.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 83.11% | 94.45% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.83% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.77% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.67% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia officinarum |
Costus spicatus |
Prosopis juliflora |
PubChem | 74978140 |
LOTUS | LTS0052542 |
wikiData | Q105170306 |