4-Methoxy-9,10-dihydrophenanthrene-1,2,7-triol
| Internal ID | 86693860-29a5-41dd-852e-c3e70c7a6b56 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 4-methoxy-9,10-dihydrophenanthrene-1,2,7-triol |
| SMILES (Canonical) | COC1=C2C(=C(C(=C1)O)O)CCC3=C2C=CC(=C3)O |
| SMILES (Isomeric) | COC1=C2C(=C(C(=C1)O)O)CCC3=C2C=CC(=C3)O |
| InChI | InChI=1S/C15H14O4/c1-19-13-7-12(17)15(18)11-4-2-8-6-9(16)3-5-10(8)14(11)13/h3,5-7,16-18H,2,4H2,1H3 |
| InChI Key | GZUMFRSXHNRUNO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 97.24% | 98.35% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.68% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.69% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.13% | 86.33% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 91.99% | 91.00% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.93% | 91.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.56% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.19% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.04% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.94% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.93% | 99.17% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 88.62% | 98.21% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.91% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.53% | 89.62% |
| CHEMBL3194 | P02766 | Transthyretin | 87.43% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.01% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.51% | 95.89% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.78% | 98.11% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.68% | 95.64% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.57% | 95.78% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.19% | 82.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.15% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.96% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bletilla formosana |
| PubChem | 11615846 |
| LOTUS | LTS0214827 |
| wikiData | Q105024629 |