4-Methoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-5-ol
| Internal ID | 68764841-5362-4c89-9a83-36eb78a713c6 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 4-methoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-5-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H19NO2/c1-18-8-7-12-5-3-4-6-14(12)15-10-17(20-2)16(19)9-13(15)11-18/h3-6,9-10,19H,7-8,11H2,1-2H3 |
| InChI Key | ACBDSFHNUQINHT-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 32.70 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 4-Methoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/4-methoxy-9-methyl-9-azatricyclo1040027hexadeca-1162461214-hexaen-5-ol.jpg "2D Structure of 4-Methoxy-9-methyl-9-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaen-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 96.56% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.32% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.34% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.64% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.64% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.55% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.43% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 86.27% | 93.65% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.64% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.55% | 94.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.45% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.97% | 95.89% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.47% | 91.49% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 82.53% | 95.62% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.29% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Crossyne flava |
| PubChem | 10015908 |
| LOTUS | LTS0029892 |
| wikiData | Q104908998 |