Acuminatopyrone
| Internal ID | cb102049-d92d-4cf9-9ee7-d4613f671346 |
| Taxonomy | Organoheterocyclic compounds > Pyranopyridines |
| IUPAC Name | 4-methoxy-5,6-dimethylpyrano[2,3-b]pyridin-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H11NO3/c1-6-5-12-11-10(7(6)2)8(14-3)4-9(13)15-11/h4-5H,1-3H3 |
| InChI Key | RIAVJIUUQSNGLQ-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 48.40 Ų |
| XlogP | 1.60 |
| 135038-52-7 |
| 4-methoxy-7,8-dimethylpyrano(3,2-c)pyridin-2-one |
| Acuminatopyrone |
| CHEBI:202313 |
| 4-methoxy-5,6-dimethylpyrano[2,3-b]pyridin-2-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.63% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.66% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.27% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.89% | 94.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.91% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.66% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.53% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.10% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.46% | 96.00% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.43% | 81.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.41% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.20% | 93.99% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.98% | 96.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.55% | 89.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.26% | 85.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.09% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.58% | 94.45% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.44% | 92.97% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14841766 |
| LOTUS | LTS0075012 |
| wikiData | Q77370595 |