4-Methoxy-3,4a,5-trimethyl-4,5,6,7,8,8a,9,9a-octahydrobenzo[f][1]benzofuran-2-one
Internal ID | 505c79c8-1da7-4129-a0c7-d4508e02d1b5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | 4-methoxy-3,4a,5-trimethyl-4,5,6,7,8,8a,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
SMILES (Canonical) | CC1CCCC2C1(C(C3=C(C(=O)OC3C2)C)OC)C |
SMILES (Isomeric) | CC1CCCC2C1(C(C3=C(C(=O)OC3C2)C)OC)C |
InChI | InChI=1S/C16H24O3/c1-9-6-5-7-11-8-12-13(10(2)15(17)19-12)14(18-4)16(9,11)3/h9,11-12,14H,5-8H2,1-4H3 |
InChI Key | WCODIXDFMCJVPU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H24O3 |
Molecular Weight | 264.36 g/mol |
Exact Mass | 264.17254462 g/mol |
Topological Polar Surface Area (TPSA) | 35.50 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.46% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.50% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.75% | 99.23% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.65% | 91.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.52% | 97.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.76% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.83% | 86.33% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.78% | 97.05% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.10% | 92.94% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.33% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.37% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.05% | 91.07% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.04% | 93.03% |
CHEMBL2581 | P07339 | Cathepsin D | 80.92% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia virgaurea |
PubChem | 163016546 |
LOTUS | LTS0113491 |
wikiData | Q105301912 |