4'-Methoxy-2',3,7-trihydroxyisoflavanone
| Internal ID | 75684ef7-5ba3-4242-b867-f8b82900145e |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 4-O-methylated isoflavonoids |
| IUPAC Name | 3,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-2H-chromen-4-one |
| SMILES (Canonical) | COC1=CC(=C(C=C1)C2(COC3=C(C2=O)C=CC(=C3)O)O)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)C2(COC3=C(C2=O)C=CC(=C3)O)O)O |
| InChI | InChI=1S/C16H14O6/c1-21-10-3-5-12(13(18)7-10)16(20)8-22-14-6-9(17)2-4-11(14)15(16)19/h2-7,17-18,20H,8H2,1H3 |
| InChI Key | KZBMBIHZXUQFOR-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 1.60 |
| SCHEMBL17963716 |
| CHEBI:174889 |
| DTXSID601341659 |
| 3,7-dihydroxy-3-(2-hydroxy-4-methoxyphenyl)-2H-chromen-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.53% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.73% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.03% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.96% | 90.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.53% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.42% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.02% | 99.15% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.31% | 83.82% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.52% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.81% | 86.33% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.51% | 93.40% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.81% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.89% | 91.07% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.83% | 92.94% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.69% | 95.53% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.16% | 99.23% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.04% | 93.31% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.92% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.00% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.89% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.78% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia odorifera |
| Maackia amurensis |
| PubChem | 77181160 |
| LOTUS | LTS0166038 |
| wikiData | Q105148074 |