4-Methoxy-2,3-methylendioxyxanthon
| Internal ID | 4069127c-f1ed-4c3c-b9c8-a22aa4c90374 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 4-methoxy-[1,3]dioxolo[4,5-b]xanthen-10-one |
| SMILES (Canonical) | COC1=C2C(=CC3=C1OCO3)C(=O)C4=CC=CC=C4O2 |
| SMILES (Isomeric) | COC1=C2C(=CC3=C1OCO3)C(=O)C4=CC=CC=C4O2 |
| InChI | InChI=1S/C15H10O5/c1-17-15-13-9(6-11-14(15)19-7-18-11)12(16)8-4-2-3-5-10(8)20-13/h2-6H,7H2,1H3 |
| InChI Key | VVUQORLQHOKQDW-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 54.00 Ų |
| XlogP | 2.70 |
| 4-Methoxy-2,3-methylendioxyxanthon |
| BDBM50485137 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.85% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.09% | 96.77% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.43% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.22% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.17% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.24% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.60% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.12% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.84% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.65% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.98% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.68% | 96.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.21% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.13% | 94.45% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 81.72% | 85.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.59% | 80.96% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.54% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kielmeyera rubriflora |
| Kielmeyera rupestris |
| PubChem | 70687907 |
| LOTUS | LTS0075214 |
| wikiData | Q104199829 |