(4-methoxy-1H-indol-3-yl)methanamine
| Internal ID | 64e1d79b-0d60-4e26-a399-cabee48d5013 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | (4-methoxy-1H-indol-3-yl)methanamine |
| SMILES (Canonical) | COC1=CC=CC2=C1C(=CN2)CN |
| SMILES (Isomeric) | COC1=CC=CC2=C1C(=CN2)CN |
| InChI | InChI=1S/C10H12N2O/c1-13-9-4-2-3-8-10(9)7(5-11)6-12-8/h2-4,6,12H,5,11H2,1H3 |
| InChI Key | YKDYCKHEKOEVJM-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.094963011 g/mol |
| Topological Polar Surface Area (TPSA) | 51.00 Ų |
| XlogP | 0.90 |
| 153310-48-6 |
| 4-methoxy-1h-indol-3-methylamine |
| 1-(4-methoxy-1H-indol-3-yl)methanamine |
| 4-methoxy-3-indolylmethylamine |
| 4-MeO-I3CH2NH2 |
| 4-Methoxyindole-3-methanamine |
| 4-methoxyindole-3-methylamine |
| 4-methoxyindol-3-ylmethylamine |
| SCHEMBL5444971 |
| 4-methoxy-3-(aminomethyl)indole |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.39% | 96.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 93.72% | 89.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.84% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.45% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 90.13% | 90.24% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.84% | 90.20% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.69% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.61% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.94% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.72% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.65% | 86.33% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.76% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.68% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.35% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.01% | 97.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.58% | 93.31% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 82.21% | 95.48% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.52% | 93.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.51% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 10931962 |
| LOTUS | LTS0142991 |
| wikiData | Q27163096 |