4-(Hydroxymethyl)-1,8-dimethyl-9,10-dihydrophenanthrene-2,7-diol
| Internal ID | 416584eb-9fd7-4363-b34c-cbcf1c272f10 |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 4-(hydroxymethyl)-1,8-dimethyl-9,10-dihydrophenanthrene-2,7-diol |
| SMILES (Canonical) | CC1=C(C=CC2=C1CCC3=C2C(=CC(=C3C)O)CO)O |
| SMILES (Isomeric) | CC1=C(C=CC2=C1CCC3=C2C(=CC(=C3C)O)CO)O |
| InChI | InChI=1S/C17H18O3/c1-9-12-3-4-13-10(2)16(20)7-11(8-18)17(13)14(12)5-6-15(9)19/h5-7,18-20H,3-4,8H2,1-2H3 |
| InChI Key | XMOXXHLEPGXDBW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.58% | 98.35% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.37% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.37% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.16% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.72% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.43% | 99.15% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.42% | 93.99% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 86.88% | 95.70% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.48% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.85% | 90.24% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.33% | 91.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.52% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.97% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Juncus effusus |
| PubChem | 10707169 |
| LOTUS | LTS0080640 |
| wikiData | Q105331332 |