4-Hydroxybutanoic acid
| Internal ID | a5ce080a-0c44-4687-86b5-f9b7855faf52 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Hydroxy fatty acids |
| IUPAC Name | 4-hydroxybutanoic acid |
| SMILES (Canonical) | C(CC(=O)O)CO |
| SMILES (Isomeric) | C(CC(=O)O)CO |
| InChI | InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7) |
| InChI Key | SJZRECIVHVDYJC-UHFFFAOYSA-N |
| Popularity | 3,266 references in papers |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.10 g/mol |
| Exact Mass | 104.047344113 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | -0.60 |
| 4-Hydroxybutyric acid |
| gamma-Hydroxybutyric acid |
| Xyrem |
| gamma-Hydroxybutyrate |
| 591-81-1 |
| 4-hydroxy-butyric acid |
| Butanoic acid, 4-hydroxy- |
| Oxybate |
| 4-Hydroxybutanoate |
| Gamma Hydroxybutyric Acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.59% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.41% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.44% | 98.95% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.22% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| Lotus corniculatus |
| PubChem | 10413 |
| LOTUS | LTS0101881 |
| wikiData | Q207920 |