[4-Hydroxy-6-(3-methyl-4-oxooxetan-2-yl)hexan-2-yl] formate
| Internal ID | 50dc64ec-624a-4128-93fb-e06f28ea1081 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
| IUPAC Name | [4-hydroxy-6-(3-methyl-4-oxooxetan-2-yl)hexan-2-yl] formate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H18O5/c1-7(15-6-12)5-9(13)3-4-10-8(2)11(14)16-10/h6-10,13H,3-5H2,1-2H3 |
| InChI Key | QOJDJYDRXZTLLL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of [4-Hydroxy-6-(3-methyl-4-oxooxetan-2-yl)hexan-2-yl] formate](https://plantaedb.com/storage/docs/compounds/2023/11/4-hydroxy-6-3-methyl-4-oxooxetan-2-ylhexan-2-yl-formate.jpg "2D Structure of [4-Hydroxy-6-(3-methyl-4-oxooxetan-2-yl)hexan-2-yl] formate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.62% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.02% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.97% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.12% | 97.25% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.53% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.99% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.00% | 94.73% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.66% | 96.47% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.50% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.06% | 86.92% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.54% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163014905 |
| LOTUS | LTS0014945 |
| wikiData | Q104196024 |