[4-Hydroxy-5-methyl-2-(6-methylhept-5-en-2-yl)phenyl] 3-methylbutanoate
| Internal ID | 567aac04-527e-4293-96d9-6af67157e823 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [4-hydroxy-5-methyl-2-(6-methylhept-5-en-2-yl)phenyl] 3-methylbutanoate |
| SMILES (Canonical) | CC1=CC(=C(C=C1O)C(C)CCC=C(C)C)OC(=O)CC(C)C |
| SMILES (Isomeric) | CC1=CC(=C(C=C1O)C(C)CCC=C(C)C)OC(=O)CC(C)C |
| InChI | InChI=1S/C20H30O3/c1-13(2)8-7-9-15(5)17-12-18(21)16(6)11-19(17)23-20(22)10-14(3)4/h8,11-12,14-15,21H,7,9-10H2,1-6H3 |
| InChI Key | PWAPKQMZRQMUMX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.21949481 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 6.00 |
| There are no found synonyms. |
![2D Structure of [4-Hydroxy-5-methyl-2-(6-methylhept-5-en-2-yl)phenyl] 3-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-hydroxy-5-methyl-2-6-methylhept-5-en-2-ylphenyl-3-methylbutanoate.jpg "2D Structure of [4-Hydroxy-5-methyl-2-(6-methylhept-5-en-2-yl)phenyl] 3-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.74% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.69% | 98.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.39% | 97.21% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.80% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.35% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.55% | 90.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.28% | 96.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.43% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.86% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.20% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.76% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.95% | 99.15% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.39% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.03% | 89.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.45% | 96.90% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.03% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acourtia carpholepis |
| PubChem | 162852152 |
| LOTUS | LTS0131820 |
| wikiData | Q105215713 |