4'-Hydroxy-5-methoxyflavone
| Internal ID | 6580339f-0801-418c-8139-e33e2c40ef6f |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 5-O-methylated flavonoids |
| IUPAC Name | 2-(4-hydroxyphenyl)-5-methoxychromen-4-one |
| SMILES (Canonical) | COC1=CC=CC2=C1C(=O)C=C(O2)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | COC1=CC=CC2=C1C(=O)C=C(O2)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C16H12O4/c1-19-13-3-2-4-14-16(13)12(18)9-15(20-14)10-5-7-11(17)8-6-10/h2-9,17H,1H3 |
| InChI Key | SOXQLRMCWAKIPS-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 1.90 |
| 106848-87-7 |
| 2-(4-hydroxyphenyl)-5-methoxychromen-4-one |
| 2-(4-hydroxyphenyl)-5-methoxy-4H-chromen-4-one |
| 4/'-HYDROXY-5-METHOXYFLAVONE |
| TNP00059 |
| ST056004 |
| CHEMBL242384 |
| SCHEMBL4649207 |
| DTXSID20350271 |
| SOXQLRMCWAKIPS-UHFFFAOYSA-N |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.96% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.15% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.11% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.55% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.06% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.85% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.42% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.67% | 98.75% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 88.15% | 94.03% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.46% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.11% | 99.23% |
| CHEMBL3194 | P02766 | Transthyretin | 83.72% | 90.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.99% | 97.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.84% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.08% | 95.50% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.81% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dirca palustris |
| PubChem | 676305 |
| LOTUS | LTS0209079 |
| wikiData | Q82126122 |