4'-Hydroxy-3,7,3',5'-tetramethoxyflavone
Internal ID | 3c71373f-4cd4-4c21-9b1e-679dd2bb7cbd |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dimethoxychromen-4-one |
SMILES (Canonical) | COC1=CC2=C(C=C1)C(=O)C(=C(O2)C3=CC(=C(C(=C3)OC)O)OC)OC |
SMILES (Isomeric) | COC1=CC2=C(C=C1)C(=O)C(=C(O2)C3=CC(=C(C(=C3)OC)O)OC)OC |
InChI | InChI=1S/C19H18O7/c1-22-11-5-6-12-13(9-11)26-18(19(25-4)16(12)20)10-7-14(23-2)17(21)15(8-10)24-3/h5-9,21H,1-4H3 |
InChI Key | JPZRECLLDITGML-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H18O7 |
Molecular Weight | 358.30 g/mol |
Exact Mass | 358.10525291 g/mol |
Topological Polar Surface Area (TPSA) | 83.40 Ų |
XlogP | 2.90 |
LMPK12111582 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.24% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.70% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.15% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.41% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.84% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 88.72% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.56% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.64% | 93.31% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.23% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.10% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.71% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.26% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.47% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.95% | 94.73% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.78% | 94.42% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.52% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.48% | 99.23% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.03% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Duroia hirsuta |
PubChem | 10642125 |
LOTUS | LTS0052340 |
wikiData | Q105133406 |