4-Hydroxy-3-methylbenzaldehyde
| Internal ID | 98896acc-54b7-422f-9151-0028e0779a25 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Benzaldehydes > Hydroxybenzaldehydes |
| IUPAC Name | 4-hydroxy-3-methylbenzaldehyde |
| SMILES (Canonical) | CC1=C(C=CC(=C1)C=O)O |
| SMILES (Isomeric) | CC1=C(C=CC(=C1)C=O)O |
| InChI | InChI=1S/C8H8O2/c1-6-4-7(5-9)2-3-8(6)10/h2-5,10H,1H3 |
| InChI Key | BAKYASSDAXQKKY-UHFFFAOYSA-N |
| Popularity | 17 references in papers |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.052429494 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 0.80 |
| 15174-69-3 |
| 4-Hydroxy-3-methyl-benzaldehyde |
| Benzaldehyde, 4-hydroxy-3-methyl- |
| 3-methyl-4-hydroxybenzaldehyde |
| MFCD00012360 |
| P8CUX6265J |
| 4-Hydroxy-3-methyl benzaldehyde |
| UNII-P8CUX6265J |
| aminoguanidinenitrate |
| 6-hydroxy-m-tolualdehyde |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.33% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.80% | 95.56% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 93.99% | 98.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.41% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 88.27% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.75% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.21% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.78% | 86.33% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.78% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.29% | 90.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 83.90% | 95.70% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.18% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.80% | 89.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.41% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rhizophora mangle |
| PubChem | 139901 |
| LOTUS | LTS0128577 |
| wikiData | Q27286368 |