4-Hydroxy-3-methoxy-1-methylquinolin-2(1H)-one
| Internal ID | 73a68dd2-46c8-41db-81db-3a98ddaec4bd |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroxyquinolones |
| IUPAC Name | 4-hydroxy-3-methoxy-1-methylquinolin-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H11NO3/c1-12-8-6-4-3-5-7(8)9(13)10(15-2)11(12)14/h3-6,13H,1-2H3 |
| InChI Key | UYDLHTOWSNBXTM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07389321 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 1.10 |
| 90061-39-5 |
| 4-HYDROXY-3-METHOXY-1-METHYLQUINOLIN-2-ONE |
| SCHEMBL5741498 |
| DTXSID90716284 |
| SB70017 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.22% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.08% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.46% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.99% | 91.11% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 90.54% | 80.78% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.45% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.24% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.27% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.05% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.86% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.63% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.94% | 99.23% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 85.15% | 100.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.01% | 91.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.01% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 54723909 |
| LOTUS | LTS0051802 |
| wikiData | Q82653765 |