4-Hydroxy-3-(4-hydroxyphenyl)benzoic acid
| Internal ID | 2f6cd1f5-27f4-4027-b72d-17727af96fc3 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 4-hydroxy-3-(4-hydroxyphenyl)benzoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H10O4/c14-10-4-1-8(2-5-10)11-7-9(13(16)17)3-6-12(11)15/h1-7,14-15H,(H,16,17) |
| InChI Key | NZIAZFCXJCQGBL-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3194 | P02766 | Transthyretin | 97.10% | 90.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.16% | 98.35% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 93.28% | 89.23% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 91.72% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.15% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.17% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.15% | 98.95% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 86.95% | 87.67% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.82% | 91.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.77% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.84% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.46% | 91.11% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 80.81% | 81.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.43% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71619855 |
| LOTUS | LTS0068148 |
| wikiData | Q77500712 |