4-Hydroxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one
| Internal ID | b192f4a2-486f-4cf7-a81e-1522fd5788fa |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Pyranoquinolines |
| IUPAC Name | 4-hydroxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one |
| SMILES (Canonical) | CC1(CC(C2=C(O1)C3=CC=CC=C3N(C2=O)C)O)C |
| SMILES (Isomeric) | CC1(CC(C2=C(O1)C3=CC=CC=C3N(C2=O)C)O)C |
| InChI | InChI=1S/C15H17NO3/c1-15(2)8-11(17)12-13(19-15)9-6-4-5-7-10(9)16(3)14(12)18/h4-7,11,17H,8H2,1-3H3 |
| InChI Key | ZMYYWMWQGRTPGO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
![2D Structure of 4-Hydroxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/4-hydroxy-226-trimethyl-34-dihydropyrano32-cquinolin-5-one.jpg "2D Structure of 4-Hydroxy-2,2,6-trimethyl-3,4-dihydropyrano[3,2-c]quinolin-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.21% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.26% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.64% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.15% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.67% | 93.99% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.98% | 98.59% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.43% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.22% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.98% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.51% | 86.33% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.06% | 98.46% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.92% | 97.25% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.55% | 94.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.18% | 90.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.15% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euxylophora paraensis |
| PubChem | 163041791 |
| LOTUS | LTS0193030 |
| wikiData | Q105379854 |