2-Propylquinolin-4-ol
| Internal ID | 98fe9385-08a1-4e9a-8c07-041f94527fd1 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 2-propyl-1H-quinolin-4-one |
| SMILES (Canonical) | CCCC1=CC(=O)C2=CC=CC=C2N1 |
| SMILES (Isomeric) | CCCC1=CC(=O)C2=CC=CC=C2N1 |
| InChI | InChI=1S/C12H13NO/c1-2-5-9-8-12(14)10-6-3-4-7-11(10)13-9/h3-4,6-8H,2,5H2,1H3,(H,13,14) |
| InChI Key | ASGOXASWRFTXHV-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.099714038 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 2.70 |
| 83842-64-2 |
| 4-Hydroxy-2-propylquinoline |
| 2-PROPYL-4-QUINOLINOL |
| 18813-67-7 |
| 2-Propylquinolin-4(1H)-one |
| 2-PROPYL-1H-QUINOLIN-4-ONE |
| 2-Propyl-4(1h)-quinolinone |
| SCHEMBL1388040 |
| SCHEMBL4769993 |
| SCHEMBL7420683 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.17% | 98.95% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 95.33% | 98.59% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.90% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.71% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.87% | 91.71% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.63% | 93.31% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.05% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.75% | 98.75% |
| CHEMBL2717 | Q9HCR9 | Phosphodiesterase 11A | 84.94% | 85.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.03% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.36% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.49% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.67% | 89.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.10% | 97.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.34% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Boronia ternata |
| PubChem | 12798219 |
| LOTUS | LTS0196535 |
| wikiData | Q104917813 |