4-Hydroxy-2-methoxyphenalen-1-one
| Internal ID | d5919311-a679-46e4-bbb7-3cf117129b56 |
| Taxonomy | Benzenoids > Phenalenes > Phenalenones |
| IUPAC Name | 4-hydroxy-2-methoxyphenalen-1-one |
| SMILES (Canonical) | COC1=CC2=C(C=CC3=C2C(=CC=C3)C1=O)O |
| SMILES (Isomeric) | COC1=CC2=C(C=CC3=C2C(=CC=C3)C1=O)O |
| InChI | InChI=1S/C14H10O3/c1-17-12-7-10-11(15)6-5-8-3-2-4-9(13(8)10)14(12)16/h2-7,15H,1H3 |
| InChI Key | WUXLICACQFJZDM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.95% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.77% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.10% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.64% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.17% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.18% | 90.20% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.77% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.71% | 86.33% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.10% | 96.67% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.01% | 94.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.94% | 82.69% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.09% | 99.23% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 86.08% | 80.78% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.91% | 90.24% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.28% | 93.31% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.03% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strelitzia reginae |
| PubChem | 138983293 |
| LOTUS | LTS0061274 |
| wikiData | Q105313369 |