4-Hydroxy-2-(4-hydroxy-3-prop-2-enylphenyl)benzaldehyde
Internal ID | c48d6509-da82-476e-952a-4ed7b054facc |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
IUPAC Name | 4-hydroxy-2-(4-hydroxy-3-prop-2-enylphenyl)benzaldehyde |
SMILES (Canonical) | C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)O)C=O)O |
SMILES (Isomeric) | C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)O)C=O)O |
InChI | InChI=1S/C16H14O3/c1-2-3-12-8-11(5-7-16(12)19)15-9-14(18)6-4-13(15)10-17/h2,4-10,18-19H,1,3H2 |
InChI Key | COTKFWRRQFGYKV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H14O3 |
Molecular Weight | 254.28 g/mol |
Exact Mass | 254.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of 4-Hydroxy-2-(4-hydroxy-3-prop-2-enylphenyl)benzaldehyde 2D Structure of 4-Hydroxy-2-(4-hydroxy-3-prop-2-enylphenyl)benzaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/4-hydroxy-2-4-hydroxy-3-prop-2-enylphenylbenzaldehyde.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.00% | 91.11% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.89% | 98.11% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 96.52% | 83.57% |
CHEMBL2581 | P07339 | Cathepsin D | 96.49% | 98.95% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 94.33% | 98.35% |
CHEMBL3194 | P02766 | Transthyretin | 93.61% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.59% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.54% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.84% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.01% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.56% | 96.09% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.20% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.32% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.98% | 90.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.84% | 93.40% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.57% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.23% | 89.00% |
CHEMBL4973 | P43004 | Excitatory amino acid transporter 2 | 81.40% | 98.75% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.47% | 96.12% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.00% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia officinalis |
PubChem | 162973330 |
LOTUS | LTS0007079 |
wikiData | Q104967288 |