4'-Geranyloxy-4,2'-dihydroxychalcone
Internal ID | a9fcc1c5-6257-408a-9bb2-3e95bdfa26fa |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (E)-1-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-hydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | CC(=CCCC(=CCOC1=CC(=C(C=C1)C(=O)C=CC2=CC=C(C=C2)O)O)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)O)O)/C)C |
InChI | InChI=1S/C25H28O4/c1-18(2)5-4-6-19(3)15-16-29-22-12-13-23(25(28)17-22)24(27)14-9-20-7-10-21(26)11-8-20/h5,7-15,17,26,28H,4,6,16H2,1-3H3/b14-9+,19-15+ |
InChI Key | YGNHPWQWWZLUBY-UHGDPLQBSA-N |
Popularity | 3 references in papers |
Molecular Formula | C25H28O4 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.19875937 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.90 |
4'-geranyloxyisoliquiritigenin |
CHEMBL567921 |
SCHEMBL18265489 |
LMPK12120052 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.99% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.14% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.24% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.21% | 86.33% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 93.34% | 92.51% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.05% | 93.10% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.08% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.84% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 91.65% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.07% | 96.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 87.69% | 92.08% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.10% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.74% | 95.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.45% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.38% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 85.62% | 98.75% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.90% | 92.68% |
CHEMBL3194 | P02766 | Transthyretin | 81.66% | 90.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.63% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Millettia ferruginea |
Millettia griffoniana |
Millettia usaramensis |
PubChem | 10318361 |
LOTUS | LTS0131016 |
wikiData | Q105348173 |