4-Ethyl-5-methylnonane
| Internal ID | 19464af5-123c-4d76-ba1b-883585ccf93d |
| Taxonomy | Hydrocarbons > Saturated hydrocarbons > Alkanes > Branched alkanes |
| IUPAC Name | 4-ethyl-5-methylnonane |
| SMILES (Canonical) | CCCCC(C)C(CC)CCC |
| SMILES (Isomeric) | CCCCC(C)C(CC)CCC |
| InChI | InChI=1S/C12H26/c1-5-8-10-11(4)12(7-3)9-6-2/h11-12H,5-10H2,1-4H3 |
| InChI Key | HKUUNAOHRKAJIY-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.203450829 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 6.10 |
| Nonane, 4-ethyl-5-methyl- |
| 4-ethyl-5-methyl-nonane |
| 1632-71-9 |
| 5-methyl-6-ethylnonane |
| 4-Ethyl-5-methylnonane # |
| DTXSID90333935 |
| HKUUNAOHRKAJIY-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.21% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 93.28% | 93.31% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.57% | 92.86% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.24% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.87% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.70% | 96.09% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.67% | 87.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.19% | 97.25% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.06% | 91.81% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.07% | 85.94% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.22% | 90.24% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.85% | 97.21% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.11% | 97.79% |
| CHEMBL4105838 | Q96GG9 | DCN1-like protein 1 | 80.83% | 95.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.68% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.09% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus maxima |