CID 132551413
| Internal ID | 7e6699b9-dd23-4f2b-9509-16533440c7ea |
| Taxonomy | Benzenoids > Anthracenes |
| IUPAC Name | 4-chloro-1,3-dihydroxy-6-methoxy-8,10-dimethyl-10H-anthracen-9-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H15ClO4/c1-7-4-9(22-3)5-10-8(2)14-15(17(21)13(7)10)11(19)6-12(20)16(14)18/h4-6,8,19-20H,1-3H3 |
| InChI Key | AWAFXQCIVVHHJE-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H15ClO4 |
| Molecular Weight | 318.70 g/mol |
| Exact Mass | 318.0658866 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.38% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.20% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.71% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.72% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.06% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.04% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.86% | 91.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.48% | 91.07% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.06% | 93.03% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.89% | 94.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.41% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.37% | 86.33% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.53% | 92.68% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.13% | 94.73% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.49% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.23% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132551413 |
| LOTUS | LTS0082013 |
| wikiData | Q103816489 |