4-Aminopyridine-2,3-dicarboxylic acid
| Internal ID | cb2ab2d7-3d2b-4474-8b37-aaef06e15ef9 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxylic acids |
| IUPAC Name | 4-aminopyridine-2,3-dicarboxylic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H6N2O4/c8-3-1-2-9-5(7(12)13)4(3)6(10)11/h1-2H,(H2,8,9)(H,10,11)(H,12,13) |
| InChI Key | BOUSAKJYINGFSA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.03275668 g/mol |
| Topological Polar Surface Area (TPSA) | 114.00 Ų |
| XlogP | 0.10 |
| 122475-55-2 |
| 4-Amino-2,3-pyridinedicarboxylic acid |
| SCHEMBL1243693 |
| SCHEMBL29860445 |
| BOUSAKJYINGFSA-UHFFFAOYSA-N |
| AB76521 |
| DB-412207 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.50% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.59% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.29% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14282693 |
| LOTUS | LTS0055219 |
| wikiData | Q104940699 |