4-(Aminobutyl)guanidine
| Internal ID | 3c6fab01-33d6-45e8-89b5-dcb92ae778d4 |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Guanidines |
| IUPAC Name | 2-(1-aminobutyl)guanidine |
| SMILES (Canonical) | CCCC(N)N=C(N)N |
| SMILES (Isomeric) | CCCC(N)N=C(N)N |
| InChI | InChI=1S/C5H14N4/c1-2-3-4(6)9-5(7)8/h4H,2-3,6H2,1H3,(H4,7,8,9) |
| InChI Key | ZZZRWRUUWKBDCY-UHFFFAOYSA-N |
| Popularity | 929 references in papers |
| Molecular Formula | C5H14N4 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.121846464 g/mol |
| Topological Polar Surface Area (TPSA) | 90.40 Ų |
| XlogP | -0.90 |
| 2-(1-aminobutyl)guanidine |
| SCHEMBL1736422 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.76% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.45% | 93.31% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.09% | 98.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.57% | 96.61% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.99% | 92.86% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.03% | 87.45% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.19% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Verbesina caracasana |
| PubChem | 22677198 |
| LOTUS | LTS0062145 |
| wikiData | Q105387224 |