4-(7-Methoxy-3,4-dihydro-2H-chromen-2-yl)phenol
| Internal ID | 8c3ea976-2a86-4c29-ace0-92ef2bc4e640 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)phenol |
| SMILES (Canonical) | COC1=CC2=C(CCC(O2)C3=CC=C(C=C3)O)C=C1 |
| SMILES (Isomeric) | COC1=CC2=C(CCC(O2)C3=CC=C(C=C3)O)C=C1 |
| InChI | InChI=1S/C16H16O3/c1-18-14-8-4-12-5-9-15(19-16(12)10-14)11-2-6-13(17)7-3-11/h2-4,6-8,10,15,17H,5,9H2,1H3 |
| InChI Key | HQIYVJDLRVEGDX-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 3.40 |
| 4-(7-Methoxy-3,4-dihydro-2H-chromen-2-yl)phenol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.47% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.32% | 95.89% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.31% | 91.79% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 92.16% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.91% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.77% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.74% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.92% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.63% | 92.94% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 87.47% | 95.55% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.34% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.59% | 95.78% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.29% | 94.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.17% | 93.40% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.63% | 89.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.57% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.06% | 92.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.37% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Crinum asiaticum |
| Genista tricuspidata |
| Lycoris radiata |
| Pancratium maritimum |
| Soymida febrifuga |
| PubChem | 11276880 |
| LOTUS | LTS0215770 |
| wikiData | Q104396008 |