4-(6,8-Dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butanimidamide
| Internal ID | 82bdbff3-bae8-4ad5-87ea-e904d89e37c6 |
| Taxonomy | Organoheterocyclic compounds > Tetrahydroisoquinolines |
| IUPAC Name | 4-(6,8-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butanimidamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H19N3O2/c14-12(15)3-1-2-10-13-8(4-5-16-10)6-9(17)7-11(13)18/h6-7,10,16-18H,1-5H2,(H3,14,15) |
| InChI Key | AUOYKVBMDCDLAF-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.147726857 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.89% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.86% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 94.91% | 92.94% |
| CHEMBL233 | P35372 | Mu opioid receptor | 94.72% | 97.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.03% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 90.86% | 95.62% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 90.18% | 85.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.35% | 99.17% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.07% | 96.12% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.25% | 94.75% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.16% | 97.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.43% | 95.89% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 84.06% | 97.88% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 83.75% | 95.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.47% | 93.18% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 83.21% | 94.01% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.08% | 96.95% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.28% | 96.21% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 80.23% | 94.55% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102152370 |
| LOTUS | LTS0131949 |
| wikiData | Q104919073 |