4-[(6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-2-methoxy-5-methylphenol
| Internal ID | e3694ea1-f0c8-43f9-b353-443c1aa853b7 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
| IUPAC Name | 4-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-2-methoxy-5-methylphenol |
| SMILES (Canonical) | CC1=CC(=C(C=C1CC2C3=CC(=C(C=C3CCN2)OC)OC)OC)O |
| SMILES (Isomeric) | CC1=CC(=C(C=C1CC2C3=CC(=C(C=C3CCN2)OC)OC)OC)O |
| InChI | InChI=1S/C20H25NO4/c1-12-7-17(22)18(23-2)10-14(12)8-16-15-11-20(25-4)19(24-3)9-13(15)5-6-21-16/h7,9-11,16,21-22H,5-6,8H2,1-4H3 |
| InChI Key | WUDYMJWUAJFWRM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17835828 g/mol |
| Topological Polar Surface Area (TPSA) | 60.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
![2D Structure of 4-[(6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-2-methoxy-5-methylphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-67-dimethoxy-1234-tetrahydroisoquinolin-1-ylmethyl-2-methoxy-5-methylphenol.jpg "2D Structure of 4-[(6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-2-methoxy-5-methylphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.29% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.14% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.30% | 93.99% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.93% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.79% | 97.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.31% | 91.79% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.06% | 85.14% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.00% | 96.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.95% | 92.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.44% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.23% | 89.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.08% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.42% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.69% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.52% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.04% | 97.21% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.01% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.04% | 94.75% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.70% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.62% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.20% | 91.07% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 82.42% | 95.70% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.23% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.78% | 95.89% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.39% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ocotea pittieri |
| PubChem | 162988615 |
| LOTUS | LTS0085101 |
| wikiData | Q105312996 |