4-[6-(3,4-Dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]benzene-1,2-diol
| Internal ID | 4b652cdf-de1a-4cd2-a36d-10078e983fdf |
| Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
| IUPAC Name | 4-[6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]benzene-1,2-diol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)O)O)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)O)O)OC |
| InChI | InChI=1S/C20H22O6/c1-23-17-6-4-12(8-18(17)24-2)20-14-10-25-19(13(14)9-26-20)11-3-5-15(21)16(22)7-11/h3-8,13-14,19-22H,9-10H2,1-2H3 |
| InChI Key | DJGIRFSHDONNME-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 77.40 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 4-[6-(3,4-Dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]benzene-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/11/4-6-34-dimethoxyphenyl-133a466a-hexahydrofuro34-cfuran-3-ylbenzene-12-diol.jpg "2D Structure of 4-[6-(3,4-Dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]benzene-1,2-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.32% | 92.94% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.64% | 91.49% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.10% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.99% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.76% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.55% | 89.62% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.91% | 88.48% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.67% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.74% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.09% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.80% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.75% | 94.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.33% | 97.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.78% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Melicope hayesii |
| Zanthoxylum simulans |
| PubChem | 163009207 |
| LOTUS | LTS0223212 |
| wikiData | Q104982153 |