4-(5,6,7-trimethoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-8-yl)phenol
| Internal ID | 157a7d2e-f464-4933-81ca-b2bfa60e94a2 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
| IUPAC Name | 4-(5,6,7-trimethoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-8-yl)phenol |
| SMILES (Canonical) | CC1(C=CC2=C(C3=C(C=C2O1)OC(C(C3OC)OC)C4=CC=C(C=C4)O)OC)C |
| SMILES (Isomeric) | CC1(C=CC2=C(C3=C(C=C2O1)OC(C(C3OC)OC)C4=CC=C(C=C4)O)OC)C |
| InChI | InChI=1S/C23H26O6/c1-23(2)11-10-15-16(29-23)12-17-18(20(15)25-3)21(26-4)22(27-5)19(28-17)13-6-8-14(24)9-7-13/h6-12,19,21-22,24H,1-5H3 |
| InChI Key | KAMSUIMVPLJLGA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 66.40 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 4-(5,6,7-trimethoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-8-yl)phenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-567-trimethoxy-22-dimethyl-78-dihydro-6h-pyrano32-gchromen-8-ylphenol.jpg "2D Structure of 4-(5,6,7-trimethoxy-2,2-dimethyl-7,8-dihydro-6H-pyrano[3,2-g]chromen-8-yl)phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.88% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.67% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.79% | 91.49% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 93.61% | 98.35% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.89% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.25% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.08% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.14% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.55% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.88% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.46% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.01% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.92% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.29% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.98% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.46% | 94.00% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.37% | 94.03% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.20% | 88.48% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.77% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonchocarpus guatemalensis |
| PubChem | 22297334 |
| LOTUS | LTS0028340 |
| wikiData | Q105137916 |