[4-(5-Formyl-7-methoxy-3-methyl-1-benzofuran-2-yl)-2-methoxyphenyl] acetate
| Internal ID | d52cdc4c-58ef-4eef-8bff-1886fcf7fdc0 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | [4-(5-formyl-7-methoxy-3-methyl-1-benzofuran-2-yl)-2-methoxyphenyl] acetate |
| SMILES (Canonical) | CC1=C(OC2=C1C=C(C=C2OC)C=O)C3=CC(=C(C=C3)OC(=O)C)OC |
| SMILES (Isomeric) | CC1=C(OC2=C1C=C(C=C2OC)C=O)C3=CC(=C(C=C3)OC(=O)C)OC |
| InChI | InChI=1S/C20H18O6/c1-11-15-7-13(10-21)8-18(24-4)20(15)26-19(11)14-5-6-16(25-12(2)22)17(9-14)23-3/h5-10H,1-4H3 |
| InChI Key | AEJKWMJVHWOYBU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.11033829 g/mol |
| Topological Polar Surface Area (TPSA) | 75.00 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of [4-(5-Formyl-7-methoxy-3-methyl-1-benzofuran-2-yl)-2-methoxyphenyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/4-5-formyl-7-methoxy-3-methyl-1-benzofuran-2-yl-2-methoxyphenyl-acetate.jpg "2D Structure of [4-(5-Formyl-7-methoxy-3-methyl-1-benzofuran-2-yl)-2-methoxyphenyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.96% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.94% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.88% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 91.19% | 98.11% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 89.18% | 87.67% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.95% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.61% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.00% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.91% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.19% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.55% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.69% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.08% | 94.45% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.90% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pinus taeda |
| PubChem | 101932970 |
| LOTUS | LTS0174895 |
| wikiData | Q104910098 |