Meridianin C
| Internal ID | 6cd17f5f-4644-44b4-a34b-812b984d38ea |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | 4-(5-bromo-1H-indol-3-yl)pyrimidin-2-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H9BrN4/c13-7-1-2-10-8(5-7)9(6-16-10)11-3-4-15-12(14)17-11/h1-6,16H,(H2,14,15,17) |
| InChI Key | PKQJCYXKRNGUKQ-UHFFFAOYSA-N |
| Popularity | 18 references in papers |
| Molecular Formula | C12H9BrN4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00106 g/mol |
| Topological Polar Surface Area (TPSA) | 67.60 Ų |
| XlogP | 2.30 |
| 213473-00-8 |
| Meridianin C |
| 2-Pyrimidinamine, 4-(5-bromo-1H-indol-3-yl)- |
| CHEMBL44541 |
| SCHEMBL1612228 |
| BDBM10840 |
| DTXSID50434275 |
| PKQJCYXKRNGUKQ-UHFFFAOYSA-N |
| MFCD22552582 |
| AKOS027469387 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 |
220 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 99.87% | 96.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.77% | 91.49% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 95.85% | 93.24% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 95.15% | 91.38% |
| CHEMBL5543 | Q9Y463 | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | 94.33% | 94.70% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.24% | 94.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.51% | 92.94% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.81% | 89.62% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 90.93% | 82.86% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.70% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.28% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.67% | 98.75% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 87.51% | 89.49% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.61% | 96.00% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.29% | 85.49% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.94% | 96.67% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.76% | 100.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.73% | 97.00% |
| CHEMBL240 | Q12809 | HERG | 83.21% | 89.76% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 82.99% | 91.73% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.84% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.89% | 95.89% |
| CHEMBL4158 | P49327 | Fatty acid synthase | 81.31% | 82.50% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.85% | 96.39% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.78% | 95.56% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.75% | 96.28% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 80.40% | 95.71% |
| CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 80.13% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10017019 |
| LOTUS | LTS0073686 |
| wikiData | Q82248635 |