[4-(5-Acetyl-2-methoxyphenyl)-2-methylbut-2-enyl] 2-methylbut-2-enoate
| Internal ID | 4d7cc329-28f1-4c76-9681-9606db82eb7a |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | [4-(5-acetyl-2-methoxyphenyl)-2-methylbut-2-enyl] 2-methylbut-2-enoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H24O4/c1-6-14(3)19(21)23-12-13(2)7-8-17-11-16(15(4)20)9-10-18(17)22-5/h6-7,9-11H,8,12H2,1-5H3 |
| InChI Key | UCCITPSMRQQWHR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
![2D Structure of [4-(5-Acetyl-2-methoxyphenyl)-2-methylbut-2-enyl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-5-acetyl-2-methoxyphenyl-2-methylbut-2-enyl-2-methylbut-2-enoate.jpg "2D Structure of [4-(5-Acetyl-2-methoxyphenyl)-2-methylbut-2-enyl] 2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.82% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.00% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.51% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.47% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.43% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.13% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.88% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.46% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.18% | 90.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.55% | 94.73% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.38% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.04% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.44% | 97.21% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 80.47% | 94.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.10% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stomatanthes corumbensis |
| PubChem | 162957042 |
| LOTUS | LTS0069658 |
| wikiData | Q105269811 |